C15H16F3NO2 — CID 14436608
N-benzyl-3,3,3-trifluoro-2-(oxan-2-yloxy)prop-1-en-1-imine (PubChem CID 14436608) has the molecular formula C15H16F3NO2 and a molecular weight of 299.29 g/mol. Its IUPAC name is N-benzyl-3,3,3-trifluoro-2-(oxan-2-yloxy)prop-1-en-1-imine.
| Compound Name | N-benzyl-3,3,3-trifluoro-2-(oxan-2-yloxy)prop-1-en-1-imine |
|---|---|
| PubChem CID | 14436608 |
| Molecular Formula | C15H16F3NO2 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | N-benzyl-3,3,3-trifluoro-2-(oxan-2-yloxy)prop-1-en-1-imine |
| SMILES | FC(F)(F)C(=C=NCc1ccccc1)OC1CCCCO1 |
| InChI | InChI=1S/C15H16F3NO2/c16-15(17,18)13(21-14-8-4-5-9-20-14)11-19-10-12-6-2-1-3-7-12/h1-3,6-7,14H,4-5,8-10H2 |
| InChIKey | NHIQAQDNPZWTDF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|