C12H12F3NO2 — CID 134986240
N-benzyl-3,3,3-trifluoro-2-(methoxymethoxy)prop-1-en-1-imine (PubChem CID 134986240) has the molecular formula C12H12F3NO2 and a molecular weight of 259.23 g/mol. Its IUPAC name is N-benzyl-3,3,3-trifluoro-2-(methoxymethoxy)prop-1-en-1-imine.
| Compound Name | N-benzyl-3,3,3-trifluoro-2-(methoxymethoxy)prop-1-en-1-imine |
|---|---|
| PubChem CID | 134986240 |
| Molecular Formula | C12H12F3NO2 |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | N-benzyl-3,3,3-trifluoro-2-(methoxymethoxy)prop-1-en-1-imine |
| SMILES | COCOC(=C=NCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C12H12F3NO2/c1-17-9-18-11(12(13,14)15)8-16-7-10-5-3-2-4-6-10/h2-6H,7,9H2,1H3 |
| InChIKey | VSMHCWNRBQARGU-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|