C12H14F3NO2 — CID 171922386
2,2-dimethoxy-N-[[4-(trifluoromethyl)phenyl]methyl]ethanimine (PubChem CID 171922386) has the molecular formula C12H14F3NO2 and a molecular weight of 261.24 g/mol. Its IUPAC name is 2,2-dimethoxy-N-[[4-(trifluoromethyl)phenyl]methyl]ethanimine.
| Compound Name | 2,2-dimethoxy-N-[[4-(trifluoromethyl)phenyl]methyl]ethanimine |
|---|---|
| PubChem CID | 171922386 |
| Molecular Formula | C12H14F3NO2 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 2,2-dimethoxy-N-[[4-(trifluoromethyl)phenyl]methyl]ethanimine |
| SMILES | COC(/C=N/Cc1ccc(C(F)(F)F)cc1)OC |
| InChI | InChI=1S/C12H14F3NO2/c1-17-11(18-2)8-16-7-9-3-5-10(6-4-9)12(13,14)15/h3-6,8,11H,7H2,1-2H3/b16-8+ |
| InChIKey | XQHMOSNBPYOXGC-LZYBPNLTSA-N |
| XLogP | 2.90 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|