C14H21NO2 — CID 72819751
2,2-diethoxy-N-(1-phenylethyl)ethanimine (PubChem CID 72819751) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 2,2-diethoxy-N-(1-phenylethyl)ethanimine.
| Compound Name | 2,2-diethoxy-N-(1-phenylethyl)ethanimine |
|---|---|
| PubChem CID | 72819751 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 2,2-diethoxy-N-(1-phenylethyl)ethanimine |
| SMILES | CCOC(/C=N/C(C)c1ccccc1)OCC |
| InChI | InChI=1S/C14H21NO2/c1-4-16-14(17-5-2)11-15-12(3)13-9-7-6-8-10-13/h6-12,14H,4-5H2,1-3H3/b15-11+ |
| InChIKey | GKMNSMOMOIZIDW-RVDMUPIBSA-N |
| XLogP | 3.22 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|