C14H14F9NO2 — CID 138968689
2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethoxy)-N-[[4-(trifluoromethyl)phenyl]methyl]ethanamine (PubChem CID 138968689) has the molecular formula C14H14F9NO2 and a molecular weight of 399.25 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethoxy)-N-[[4-(trifluoromethyl)phenyl]methyl]ethanamine.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethoxy)-N-[[4-(trifluoromethyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 138968689 |
| Molecular Formula | C14H14F9NO2 |
| Molecular Weight | 399.25 g/mol |
| Exact Mass | 399.09 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxymethoxy)-N-[[4-(trifluoromethyl)phenyl]methyl]ethanamine |
| SMILES | FC(F)(F)c1ccc(CNCCOCOC(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H14F9NO2/c15-12(16,17)10-3-1-9(2-4-10)7-24-5-6-25-8-26-11(13(18,19)20)14(21,22)23/h1-4,11,24H,5-8H2 |
| InChIKey | BCOSWBFOMNMDTG-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.25 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|