C29H45N3O3 — CID 142122260
2-[4-(2,3-dihydro-1-benzofuran-5-yl)-2-[4-methyl-3-[(Z)-prop-1-enyl]iminopentyl]pyrrolidin-1-yl]-N-propoxy-N-propylacetamide (PubChem CID 142122260) has the molecular formula C29H45N3O3 and a molecular weight of 483.70 g/mol. Its IUPAC name is 2-[4-(2,3-dihydro-1-benzofuran-5-yl)-2-[4-methyl-3-[(Z)-prop-1-enyl]iminopentyl]pyrrolidin-1-yl]-N-propoxy-N-propylacetamide.
| Compound Name | 2-[4-(2,3-dihydro-1-benzofuran-5-yl)-2-[4-methyl-3-[(Z)-prop-1-enyl]iminopentyl]pyrrolidin-1-yl]-N-propoxy-N-propylacetamide |
|---|---|
| PubChem CID | 142122260 |
| Molecular Formula | C29H45N3O3 |
| Molecular Weight | 483.70 g/mol |
| Exact Mass | 483.35 |
| IUPAC Name | 2-[4-(2,3-dihydro-1-benzofuran-5-yl)-2-[4-methyl-3-[(Z)-prop-1-enyl]iminopentyl]pyrrolidin-1-yl]-N-propoxy-N-propylacetamide |
| SMILES | C/C=C\N=C(\CCC1CC(c2ccc3c(c2)CCO3)CN1CC(=O)N(CCC)OCCC)C(C)C |
| InChI | InChI=1S/C29H45N3O3/c1-6-14-30-27(22(4)5)11-10-26-19-25(23-9-12-28-24(18-23)13-17-34-28)20-31(26)21-29(33)32(15-7-2)35-16-8-3/h6,9,12,14,18,22,25-26H,7-8,10-11,13,15-17,19-21H2,1-5H3/b14-6-,30-27- |
| InChIKey | OLZDINWNFJTWMU-AUKGJYQKSA-N |
| XLogP | 5.77 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.70 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|