About 1-cyclopentyl-3-sulfanyloctan-3-ol;methyl (Z)-hept-5-enoate
1-cyclopentyl-3-sulfanyloctan-3-ol;methyl (Z)-hept-5-enoate (PubChem CID 142123069) has the molecular formula C21H40O3S
and a molecular weight of 372.62 g/mol. Its IUPAC name is 1-cyclopentyl-3-sulfanyloctan-3-ol;methyl (Z)-hept-5-enoate.
Molecular Properties
| Compound Name | 1-cyclopentyl-3-sulfanyloctan-3-ol;methyl (Z)-hept-5-enoate |
| PubChem CID | 142123069 |
| Molecular Formula | C21H40O3S |
| Molecular Weight | 372.62 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | 1-cyclopentyl-3-sulfanyloctan-3-ol;methyl (Z)-hept-5-enoate |
| SMILES | C/C=C\CCCC(=O)OC.CCCCCC(O)(S)CCC1CCCC1 |
| InChI | InChI=1S/C13H26OS.C8H14O2/c1-2-3-6-10-13(14,15)11-9-12-7-4-5-8-12;1-3-4-5-6-7-8(9)10-2/h12,14-15H,2-11H2,1H3;3-4H,5-7H2,1-2H3/b;4-3- |
| InChIKey | QHBYIQHTOMRKFF-QGAMPUOQSA-N |
| XLogP | 6.06 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.62 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclopentyl-3-sulfanyloctan-3-ol;methyl (Z)-hept-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-3-sulfanyloctan-3-ol;methyl (Z)-hept-5-enoate?
The IUPAC name of 1-cyclopentyl-3-sulfanyloctan-3-ol;methyl (Z)-hept-5-enoate (CID 142123069) is 1-cyclopentyl-3-sulfanyloctan-3-ol;methyl (Z)-hept-5-enoate.
What is the SMILES notation for 1-cyclopentyl-3-sulfanyloctan-3-ol;methyl (Z)-hept-5-enoate?
The canonical SMILES for 1-cyclopentyl-3-sulfanyloctan-3-ol;methyl (Z)-hept-5-enoate is C/C=C\CCCC(=O)OC.CCCCCC(O)(S)CCC1CCCC1.
What is the InChIKey of 1-cyclopentyl-3-sulfanyloctan-3-ol;methyl (Z)-hept-5-enoate?
The InChIKey is QHBYIQHTOMRKFF-QGAMPUOQSA-N. The full InChI is InChI=1S/C13H26OS.C8H14O2/c1-2-3-6-10-13(14,15)11-9-12-7-4-5-8-12;1-3-4-5-6-7-8(9)10-2/h12,14-15H,2-11H2,1H3;3-4H,5-7H2,1-2H3/b;4-3-.
What are the key properties of 1-cyclopentyl-3-sulfanyloctan-3-ol;methyl (Z)-hept-5-enoate?
1-cyclopentyl-3-sulfanyloctan-3-ol;methyl (Z)-hept-5-enoate has a molecular weight of 372.62 g/mol, XLogP of 6.06, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-3-sulfanyloctan-3-ol;methyl (Z)-hept-5-enoate is sourced from PubChem (CID 142123069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).