C9H12F2O — CID 142123447
1-(difluoromethoxy)-4-ethylcyclohexa-1,3-diene (PubChem CID 142123447) has the molecular formula C9H12F2O and a molecular weight of 174.19 g/mol. Its IUPAC name is 1-(difluoromethoxy)-4-ethylcyclohexa-1,3-diene.
| Compound Name | 1-(difluoromethoxy)-4-ethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 142123447 |
| Molecular Formula | C9H12F2O |
| Molecular Weight | 174.19 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 1-(difluoromethoxy)-4-ethylcyclohexa-1,3-diene |
| SMILES | CCC1=CC=C(OC(F)F)CC1 |
| InChI | InChI=1S/C9H12F2O/c1-2-7-3-5-8(6-4-7)12-9(10)11/h3,5,9H,2,4,6H2,1H3 |
| InChIKey | AGBYZQDFIOQLJA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.19 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |