About N-(3-ethyl-3H-isoindol-1-yl)-7-[2-(trifluoromethyl)phenyl]-1,6-naphthyridin-5-amine
N-(3-ethyl-3H-isoindol-1-yl)-7-[2-(trifluoromethyl)phenyl]-1,6-naphthyridin-5-amine (PubChem CID 142125698) has the molecular formula C25H19F3N4
and a molecular weight of 432.45 g/mol. Its IUPAC name is N-(3-ethyl-3H-isoindol-1-yl)-7-[2-(trifluoromethyl)phenyl]-1,6-naphthyridin-5-amine.
Molecular Properties
| Compound Name | N-(3-ethyl-3H-isoindol-1-yl)-7-[2-(trifluoromethyl)phenyl]-1,6-naphthyridin-5-amine |
| PubChem CID | 142125698 |
| Molecular Formula | C25H19F3N4 |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | N-(3-ethyl-3H-isoindol-1-yl)-7-[2-(trifluoromethyl)phenyl]-1,6-naphthyridin-5-amine |
| SMILES | CCC1N=C(Nc2nc(-c3ccccc3C(F)(F)F)cc3ncccc23)c2ccccc21 |
| InChI | InChI=1S/C25H19F3N4/c1-2-20-15-8-3-4-9-16(15)23(30-20)32-24-18-11-7-13-29-21(18)14-22(31-24)17-10-5-6-12-19(17)25(26,27)28/h3-14,20H,2H2,1H3,(H,30,31,32) |
| InChIKey | LZEWHKDSQLMQNX-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(3-ethyl-3H-isoindol-1-yl)-7-[2-(trifluoromethyl)phenyl]-1,6-naphthyridin-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-ethyl-3H-isoindol-1-yl)-7-[2-(trifluoromethyl)phenyl]-1,6-naphthyridin-5-amine?
The IUPAC name of N-(3-ethyl-3H-isoindol-1-yl)-7-[2-(trifluoromethyl)phenyl]-1,6-naphthyridin-5-amine (CID 142125698) is N-(3-ethyl-3H-isoindol-1-yl)-7-[2-(trifluoromethyl)phenyl]-1,6-naphthyridin-5-amine.
What is the SMILES notation for N-(3-ethyl-3H-isoindol-1-yl)-7-[2-(trifluoromethyl)phenyl]-1,6-naphthyridin-5-amine?
The canonical SMILES for N-(3-ethyl-3H-isoindol-1-yl)-7-[2-(trifluoromethyl)phenyl]-1,6-naphthyridin-5-amine is CCC1N=C(Nc2nc(-c3ccccc3C(F)(F)F)cc3ncccc23)c2ccccc21.
What is the InChIKey of N-(3-ethyl-3H-isoindol-1-yl)-7-[2-(trifluoromethyl)phenyl]-1,6-naphthyridin-5-amine?
The InChIKey is LZEWHKDSQLMQNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H19F3N4/c1-2-20-15-8-3-4-9-16(15)23(30-20)32-24-18-11-7-13-29-21(18)14-22(31-24)17-10-5-6-12-19(17)25(26,27)28/h3-14,20H,2H2,1H3,(H,30,31,32).
What are the key properties of N-(3-ethyl-3H-isoindol-1-yl)-7-[2-(trifluoromethyl)phenyl]-1,6-naphthyridin-5-amine?
N-(3-ethyl-3H-isoindol-1-yl)-7-[2-(trifluoromethyl)phenyl]-1,6-naphthyridin-5-amine has a molecular weight of 432.45 g/mol, XLogP of 6.64, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-ethyl-3H-isoindol-1-yl)-7-[2-(trifluoromethyl)phenyl]-1,6-naphthyridin-5-amine is sourced from PubChem (CID 142125698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).