C23H26F3N5 — CID 162578294
(1Z,3E)-1-N'-ethyl-4-N'-(3-ethyl-3H-isoindol-1-yl)-2-[2-(trifluoromethyl)phenyl]buta-1,3-diene-1,1,4,4-tetramine (PubChem CID 162578294) has the molecular formula C23H26F3N5 and a molecular weight of 429.49 g/mol. Its IUPAC name is (1Z,3E)-1-N'-ethyl-4-N'-(3-ethyl-3H-isoindol-1-yl)-2-[2-(trifluoromethyl)phenyl]buta-1,3-diene-1,1,4,4-tetramine.
| Compound Name | (1Z,3E)-1-N'-ethyl-4-N'-(3-ethyl-3H-isoindol-1-yl)-2-[2-(trifluoromethyl)phenyl]buta-1,3-diene-1,1,4,4-tetramine |
|---|---|
| PubChem CID | 162578294 |
| Molecular Formula | C23H26F3N5 |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | (1Z,3E)-1-N'-ethyl-4-N'-(3-ethyl-3H-isoindol-1-yl)-2-[2-(trifluoromethyl)phenyl]buta-1,3-diene-1,1,4,4-tetramine |
| SMILES | CCN/C(N)=C(/C=C(\N)NC1=NC(CC)c2ccccc21)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C23H26F3N5/c1-3-19-15-10-5-6-11-16(15)22(30-19)31-20(27)13-17(21(28)29-4-2)14-9-7-8-12-18(14)23(24,25)26/h5-13,19,29H,3-4,27-28H2,1-2H3,(H,30,31)/b20-13+,21-17- |
| InChIKey | JRIMYGIRZYYLNI-QBWZCQBYSA-N |
| XLogP | 4.24 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|