C29H32N4 — CID 142126644
(3Z)-2-N-(2-naphthalen-1-ylquinazolin-4-yl)-4-N,4-N-dipropylpenta-1,3-diene-2,4-diamine (PubChem CID 142126644) has the molecular formula C29H32N4 and a molecular weight of 436.60 g/mol. Its IUPAC name is (3Z)-2-N-(2-naphthalen-1-ylquinazolin-4-yl)-4-N,4-N-dipropylpenta-1,3-diene-2,4-diamine.
| Compound Name | (3Z)-2-N-(2-naphthalen-1-ylquinazolin-4-yl)-4-N,4-N-dipropylpenta-1,3-diene-2,4-diamine |
|---|---|
| PubChem CID | 142126644 |
| Molecular Formula | C29H32N4 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | (3Z)-2-N-(2-naphthalen-1-ylquinazolin-4-yl)-4-N,4-N-dipropylpenta-1,3-diene-2,4-diamine |
| SMILES | C=C(/C=C(/C)N(CCC)CCC)Nc1nc(-c2cccc3ccccc23)nc2ccccc12 |
| InChI | InChI=1S/C29H32N4/c1-5-18-33(19-6-2)22(4)20-21(3)30-29-26-15-9-10-17-27(26)31-28(32-29)25-16-11-13-23-12-7-8-14-24(23)25/h7-17,20H,3,5-6,18-19H2,1-2,4H3,(H,30,31,32)/b22-20- |
| InChIKey | RYKBGFOJZTYLTN-XDOYNYLZSA-N |
| XLogP | 7.40 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|