C27H27FN4 — CID 142127175
2-(2-ethynylphenyl)-N-[1-[5-fluoro-2-(propylamino)phenyl]ethyl]-1,2-dihydroquinazolin-4-amine (PubChem CID 142127175) has the molecular formula C27H27FN4 and a molecular weight of 426.54 g/mol. Its IUPAC name is 2-(2-ethynylphenyl)-N-[1-[5-fluoro-2-(propylamino)phenyl]ethyl]-1,2-dihydroquinazolin-4-amine.
| Compound Name | 2-(2-ethynylphenyl)-N-[1-[5-fluoro-2-(propylamino)phenyl]ethyl]-1,2-dihydroquinazolin-4-amine |
|---|---|
| PubChem CID | 142127175 |
| Molecular Formula | C27H27FN4 |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | 2-(2-ethynylphenyl)-N-[1-[5-fluoro-2-(propylamino)phenyl]ethyl]-1,2-dihydroquinazolin-4-amine |
| SMILES | C#Cc1ccccc1C1N=C(NC(C)c2cc(F)ccc2NCCC)c2ccccc2N1 |
| InChI | InChI=1S/C27H27FN4/c1-4-16-29-24-15-14-20(28)17-23(24)18(3)30-27-22-12-8-9-13-25(22)31-26(32-27)21-11-7-6-10-19(21)5-2/h2,6-15,17-18,26,29,31H,4,16H2,1,3H3,(H,30,32) |
| InChIKey | NUDURRAKSHHNKY-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 48.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|