C24H22F4N6O — CID 142127278
3-azidooxy-N-[1-[5-fluoro-2-(propylamino)phenyl]ethenyl]-2-methyl-6-[2-(trifluoromethyl)phenyl]pyridin-4-amine (PubChem CID 142127278) has the molecular formula C24H22F4N6O and a molecular weight of 486.47 g/mol. Its IUPAC name is 3-azidooxy-N-[1-[5-fluoro-2-(propylamino)phenyl]ethenyl]-2-methyl-6-[2-(trifluoromethyl)phenyl]pyridin-4-amine.
| Compound Name | 3-azidooxy-N-[1-[5-fluoro-2-(propylamino)phenyl]ethenyl]-2-methyl-6-[2-(trifluoromethyl)phenyl]pyridin-4-amine |
|---|---|
| PubChem CID | 142127278 |
| Molecular Formula | C24H22F4N6O |
| Molecular Weight | 486.47 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 3-azidooxy-N-[1-[5-fluoro-2-(propylamino)phenyl]ethenyl]-2-methyl-6-[2-(trifluoromethyl)phenyl]pyridin-4-amine |
| SMILES | C=C(Nc1cc(-c2ccccc2C(F)(F)F)nc(C)c1ON=[N+]=[N-])c1cc(F)ccc1NCCC |
| InChI | InChI=1S/C24H22F4N6O/c1-4-11-30-20-10-9-16(25)12-18(20)14(2)31-22-13-21(32-15(3)23(22)35-34-33-29)17-7-5-6-8-19(17)24(26,27)28/h5-10,12-13,30H,2,4,11H2,1,3H3,(H,31,32) |
| InChIKey | XRSIALAMVQRHPV-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.47 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|