C29H45ClF2N4 — CID 142127574
(Z)-3-amino-N-[(2-chlorophenyl)methyl]-2-ethyl-N'-methyloct-2-enimidamide;2,4-difluoro-6-propylaniline;ethane (PubChem CID 142127574) has the molecular formula C29H45ClF2N4 and a molecular weight of 523.16 g/mol. Its IUPAC name is (Z)-3-amino-N-[(2-chlorophenyl)methyl]-2-ethyl-N'-methyloct-2-enimidamide;2,4-difluoro-6-propylaniline;ethane.
| Compound Name | (Z)-3-amino-N-[(2-chlorophenyl)methyl]-2-ethyl-N'-methyloct-2-enimidamide;2,4-difluoro-6-propylaniline;ethane |
|---|---|
| PubChem CID | 142127574 |
| Molecular Formula | C29H45ClF2N4 |
| Molecular Weight | 523.16 g/mol |
| Exact Mass | 522.33 |
| IUPAC Name | (Z)-3-amino-N-[(2-chlorophenyl)methyl]-2-ethyl-N'-methyloct-2-enimidamide;2,4-difluoro-6-propylaniline;ethane |
| SMILES | CC.CCCCC/C(N)=C(CC)/C(=N/C)NCc1ccccc1Cl.CCCc1cc(F)cc(F)c1N |
| InChI | InChI=1S/C18H28ClN3.C9H11F2N.C2H6/c1-4-6-7-12-17(20)15(5-2)18(21-3)22-13-14-10-8-9-11-16(14)19;1-2-3-6-4-7(10)5-8(11)9(6)12;1-2/h8-11H,4-7,12-13,20H2,1-3H3,(H,21,22);4-5H,2-3,12H2,1H3;1-2H3/b17-15-;; |
| InChIKey | KVRDAMQGWUISKD-ODBGOXANSA-N |
| XLogP | 8.19 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.16 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|