C26H34F2N4O — CID 142126217
2-amino-N-[(2-hydroxyphenyl)methyl]-N'-methylbenzenecarboximidamide;2,4-difluoro-6-propylaniline;ethane (PubChem CID 142126217) has the molecular formula C26H34F2N4O and a molecular weight of 456.58 g/mol. Its IUPAC name is 2-amino-N-[(2-hydroxyphenyl)methyl]-N'-methylbenzenecarboximidamide;2,4-difluoro-6-propylaniline;ethane.
| Compound Name | 2-amino-N-[(2-hydroxyphenyl)methyl]-N'-methylbenzenecarboximidamide;2,4-difluoro-6-propylaniline;ethane |
|---|---|
| PubChem CID | 142126217 |
| Molecular Formula | C26H34F2N4O |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | 2-amino-N-[(2-hydroxyphenyl)methyl]-N'-methylbenzenecarboximidamide;2,4-difluoro-6-propylaniline;ethane |
| SMILES | C/N=C(\NCc1ccccc1O)c1ccccc1N.CC.CCCc1cc(F)cc(F)c1N |
| InChI | InChI=1S/C15H17N3O.C9H11F2N.C2H6/c1-17-15(12-7-3-4-8-13(12)16)18-10-11-6-2-5-9-14(11)19;1-2-3-6-4-7(10)5-8(11)9(6)12;1-2/h2-9,19H,10,16H2,1H3,(H,17,18);4-5H,2-3,12H2,1H3;1-2H3 |
| InChIKey | MIWZCWDOHYCXJP-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|