C15H18N4O2S — CID 142127726
2-amino-N'-methyl-N-[(2-sulfamoylphenyl)methyl]benzenecarboximidamide (PubChem CID 142127726) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is 2-amino-N'-methyl-N-[(2-sulfamoylphenyl)methyl]benzenecarboximidamide.
| Compound Name | 2-amino-N'-methyl-N-[(2-sulfamoylphenyl)methyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 142127726 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 2-amino-N'-methyl-N-[(2-sulfamoylphenyl)methyl]benzenecarboximidamide |
| SMILES | C/N=C(/NCc1ccccc1S(N)(=O)=O)c1ccccc1N |
| InChI | InChI=1S/C15H18N4O2S/c1-18-15(12-7-3-4-8-13(12)16)19-10-11-6-2-5-9-14(11)22(17,20)21/h2-9H,10,16H2,1H3,(H,18,19)(H2,17,20,21) |
| InChIKey | FTEZPDHGYICSKU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|