C10H14BrNO2S — CID 63203633
2-(2-bromobutyl)benzenesulfonamide (PubChem CID 63203633) has the molecular formula C10H14BrNO2S and a molecular weight of 292.20 g/mol. Its IUPAC name is 2-(2-bromobutyl)benzenesulfonamide.
| Compound Name | 2-(2-bromobutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 63203633 |
| Molecular Formula | C10H14BrNO2S |
| Molecular Weight | 292.20 g/mol |
| Exact Mass | 290.99 |
| IUPAC Name | 2-(2-bromobutyl)benzenesulfonamide |
| SMILES | CCC(Br)Cc1ccccc1S(N)(=O)=O |
| InChI | InChI=1S/C10H14BrNO2S/c1-2-9(11)7-8-5-3-4-6-10(8)15(12,13)14/h3-6,9H,2,7H2,1H3,(H2,12,13,14) |
| InChIKey | XYOHANCOZGACLJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.20 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|