C12H15BrF2O2S — CID 55220091
1-(2-bromopentyl)-2-(difluoromethylsulfonyl)benzene (PubChem CID 55220091) has the molecular formula C12H15BrF2O2S and a molecular weight of 341.22 g/mol. Its IUPAC name is 1-(2-bromopentyl)-2-(difluoromethylsulfonyl)benzene.
| Compound Name | 1-(2-bromopentyl)-2-(difluoromethylsulfonyl)benzene |
|---|---|
| PubChem CID | 55220091 |
| Molecular Formula | C12H15BrF2O2S |
| Molecular Weight | 341.22 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 1-(2-bromopentyl)-2-(difluoromethylsulfonyl)benzene |
| SMILES | CCCC(Br)Cc1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C12H15BrF2O2S/c1-2-5-10(13)8-9-6-3-4-7-11(9)18(16,17)12(14)15/h3-4,6-7,10,12H,2,5,8H2,1H3 |
| InChIKey | FRTGMSNBYOHDMT-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.22 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|