C14H22ClNO2S — CID 63202897
2-(2-chloropentyl)-N-propan-2-ylbenzenesulfonamide (PubChem CID 63202897) has the molecular formula C14H22ClNO2S and a molecular weight of 303.86 g/mol. Its IUPAC name is 2-(2-chloropentyl)-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 2-(2-chloropentyl)-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 63202897 |
| Molecular Formula | C14H22ClNO2S |
| Molecular Weight | 303.86 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 2-(2-chloropentyl)-N-propan-2-ylbenzenesulfonamide |
| SMILES | CCCC(Cl)Cc1ccccc1S(=O)(=O)NC(C)C |
| InChI | InChI=1S/C14H22ClNO2S/c1-4-7-13(15)10-12-8-5-6-9-14(12)19(17,18)16-11(2)3/h5-6,8-9,11,13,16H,4,7,10H2,1-3H3 |
| InChIKey | UUJOVGJCWLBYKK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.86 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|