C15H26N2O2S — CID 63196503
2-(2-amino-3,3-dimethylbutyl)-N-propan-2-ylbenzenesulfonamide (PubChem CID 63196503) has the molecular formula C15H26N2O2S and a molecular weight of 298.45 g/mol. Its IUPAC name is 2-(2-amino-3,3-dimethylbutyl)-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 2-(2-amino-3,3-dimethylbutyl)-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 63196503 |
| Molecular Formula | C15H26N2O2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 2-(2-amino-3,3-dimethylbutyl)-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)NS(=O)(=O)c1ccccc1CC(N)C(C)(C)C |
| InChI | InChI=1S/C15H26N2O2S/c1-11(2)17-20(18,19)13-9-7-6-8-12(13)10-14(16)15(3,4)5/h6-9,11,14,17H,10,16H2,1-5H3 |
| InChIKey | GUDLNXAJLUHMJM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |