C11H13ClF2O4S2 — CID 66137230
1-(4-chlorobutan-2-ylsulfonyl)-2-(difluoromethylsulfonyl)benzene (PubChem CID 66137230) has the molecular formula C11H13ClF2O4S2 and a molecular weight of 346.80 g/mol. Its IUPAC name is 1-(4-chlorobutan-2-ylsulfonyl)-2-(difluoromethylsulfonyl)benzene.
| Compound Name | 1-(4-chlorobutan-2-ylsulfonyl)-2-(difluoromethylsulfonyl)benzene |
|---|---|
| PubChem CID | 66137230 |
| Molecular Formula | C11H13ClF2O4S2 |
| Molecular Weight | 346.80 g/mol |
| Exact Mass | 345.99 |
| IUPAC Name | 1-(4-chlorobutan-2-ylsulfonyl)-2-(difluoromethylsulfonyl)benzene |
| SMILES | CC(CCCl)S(=O)(=O)c1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C11H13ClF2O4S2/c1-8(6-7-12)19(15,16)9-4-2-3-5-10(9)20(17,18)11(13)14/h2-5,8,11H,6-7H2,1H3 |
| InChIKey | CLKZBMOJKPXLQH-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.80 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|