C11H11BrClF3O2S — CID 113325995
2-bromo-1-(4-chlorobutan-2-ylsulfonyl)-4-(trifluoromethyl)benzene (PubChem CID 113325995) has the molecular formula C11H11BrClF3O2S and a molecular weight of 379.63 g/mol. Its IUPAC name is 2-bromo-1-(4-chlorobutan-2-ylsulfonyl)-4-(trifluoromethyl)benzene.
| Compound Name | 2-bromo-1-(4-chlorobutan-2-ylsulfonyl)-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 113325995 |
| Molecular Formula | C11H11BrClF3O2S |
| Molecular Weight | 379.63 g/mol |
| Exact Mass | 377.93 |
| IUPAC Name | 2-bromo-1-(4-chlorobutan-2-ylsulfonyl)-4-(trifluoromethyl)benzene |
| SMILES | CC(CCCl)S(=O)(=O)c1ccc(C(F)(F)F)cc1Br |
| InChI | InChI=1S/C11H11BrClF3O2S/c1-7(4-5-13)19(17,18)10-3-2-8(6-9(10)12)11(14,15)16/h2-3,6-7H,4-5H2,1H3 |
| InChIKey | GQPGBGUGXKJZNR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.63 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|