C12H16F2O3S — CID 63562518
2-[2-(difluoromethylsulfonyl)phenyl]pentan-3-ol (PubChem CID 63562518) has the molecular formula C12H16F2O3S and a molecular weight of 278.32 g/mol. Its IUPAC name is 2-[2-(difluoromethylsulfonyl)phenyl]pentan-3-ol.
| Compound Name | 2-[2-(difluoromethylsulfonyl)phenyl]pentan-3-ol |
|---|---|
| PubChem CID | 63562518 |
| Molecular Formula | C12H16F2O3S |
| Molecular Weight | 278.32 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 2-[2-(difluoromethylsulfonyl)phenyl]pentan-3-ol |
| SMILES | CCC(O)C(C)c1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C12H16F2O3S/c1-3-10(15)8(2)9-6-4-5-7-11(9)18(16,17)12(13)14/h4-8,10,12,15H,3H2,1-2H3 |
| InChIKey | UMJDNOQNTLUWFV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |