C11H14F2O3S2 — CID 66104428
3-[2-(difluoromethylsulfonyl)phenyl]sulfanyl-2-methylpropan-1-ol (PubChem CID 66104428) has the molecular formula C11H14F2O3S2 and a molecular weight of 296.36 g/mol. Its IUPAC name is 3-[2-(difluoromethylsulfonyl)phenyl]sulfanyl-2-methylpropan-1-ol.
| Compound Name | 3-[2-(difluoromethylsulfonyl)phenyl]sulfanyl-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 66104428 |
| Molecular Formula | C11H14F2O3S2 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 3-[2-(difluoromethylsulfonyl)phenyl]sulfanyl-2-methylpropan-1-ol |
| SMILES | CC(CO)CSc1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C11H14F2O3S2/c1-8(6-14)7-17-9-4-2-3-5-10(9)18(15,16)11(12)13/h2-5,8,11,14H,6-7H2,1H3 |
| InChIKey | IVHWFDYUKIJBQV-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |