C11H14ClF2NO2S — CID 63392463
N-(2-chloropropyl)-2-(difluoromethylsulfonyl)-N-methylaniline (PubChem CID 63392463) has the molecular formula C11H14ClF2NO2S and a molecular weight of 297.75 g/mol. Its IUPAC name is N-(2-chloropropyl)-2-(difluoromethylsulfonyl)-N-methylaniline.
| Compound Name | N-(2-chloropropyl)-2-(difluoromethylsulfonyl)-N-methylaniline |
|---|---|
| PubChem CID | 63392463 |
| Molecular Formula | C11H14ClF2NO2S |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | N-(2-chloropropyl)-2-(difluoromethylsulfonyl)-N-methylaniline |
| SMILES | CC(Cl)CN(C)c1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C11H14ClF2NO2S/c1-8(12)7-15(2)9-5-3-4-6-10(9)18(16,17)11(13)14/h3-6,8,11H,7H2,1-2H3 |
| InChIKey | AUTQUCDQNNAQMZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|