C13H17F2NO2S — CID 133398357
N-(2-cyclopropylethyl)-2-(difluoromethylsulfonyl)-N-methylaniline (PubChem CID 133398357) has the molecular formula C13H17F2NO2S and a molecular weight of 289.35 g/mol. Its IUPAC name is N-(2-cyclopropylethyl)-2-(difluoromethylsulfonyl)-N-methylaniline.
| Compound Name | N-(2-cyclopropylethyl)-2-(difluoromethylsulfonyl)-N-methylaniline |
|---|---|
| PubChem CID | 133398357 |
| Molecular Formula | C13H17F2NO2S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-(2-cyclopropylethyl)-2-(difluoromethylsulfonyl)-N-methylaniline |
| SMILES | CN(CCC1CC1)c1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C13H17F2NO2S/c1-16(9-8-10-6-7-10)11-4-2-3-5-12(11)19(17,18)13(14)15/h2-5,10,13H,6-9H2,1H3 |
| InChIKey | YQZJBNVZVIEJLY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |