C12H16BrF2NO2S — CID 113476479
N-(1-bromo-2-methylpropan-2-yl)-2-(difluoromethylsulfonyl)-N-methylaniline (PubChem CID 113476479) has the molecular formula C12H16BrF2NO2S and a molecular weight of 356.23 g/mol. Its IUPAC name is N-(1-bromo-2-methylpropan-2-yl)-2-(difluoromethylsulfonyl)-N-methylaniline.
| Compound Name | N-(1-bromo-2-methylpropan-2-yl)-2-(difluoromethylsulfonyl)-N-methylaniline |
|---|---|
| PubChem CID | 113476479 |
| Molecular Formula | C12H16BrF2NO2S |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | N-(1-bromo-2-methylpropan-2-yl)-2-(difluoromethylsulfonyl)-N-methylaniline |
| SMILES | CN(c1ccccc1S(=O)(=O)C(F)F)C(C)(C)CBr |
| InChI | InChI=1S/C12H16BrF2NO2S/c1-12(2,8-13)16(3)9-6-4-5-7-10(9)19(17,18)11(14)15/h4-7,11H,8H2,1-3H3 |
| InChIKey | MGUWKDIGYQZJRF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|