C13H18F2N2O2S — CID 63643765
N-[2-(difluoromethylsulfonyl)phenyl]-N-methylpiperidin-3-amine (PubChem CID 63643765) has the molecular formula C13H18F2N2O2S and a molecular weight of 304.36 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfonyl)phenyl]-N-methylpiperidin-3-amine.
| Compound Name | N-[2-(difluoromethylsulfonyl)phenyl]-N-methylpiperidin-3-amine |
|---|---|
| PubChem CID | 63643765 |
| Molecular Formula | C13H18F2N2O2S |
| Molecular Weight | 304.36 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | N-[2-(difluoromethylsulfonyl)phenyl]-N-methylpiperidin-3-amine |
| SMILES | CN(c1ccccc1S(=O)(=O)C(F)F)C1CCCNC1 |
| InChI | InChI=1S/C13H18F2N2O2S/c1-17(10-5-4-8-16-9-10)11-6-2-3-7-12(11)20(18,19)13(14)15/h2-3,6-7,10,13,16H,4-5,8-9H2,1H3 |
| InChIKey | WQTLPIKVDYOIQE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |