C26H33F5N4 — CID 142126286
2-amino-N'-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]cycloheptene-1-carboximidamide;2,4-difluoro-6-propylaniline (PubChem CID 142126286) has the molecular formula C26H33F5N4 and a molecular weight of 496.57 g/mol. Its IUPAC name is 2-amino-N'-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]cycloheptene-1-carboximidamide;2,4-difluoro-6-propylaniline.
| Compound Name | 2-amino-N'-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]cycloheptene-1-carboximidamide;2,4-difluoro-6-propylaniline |
|---|---|
| PubChem CID | 142126286 |
| Molecular Formula | C26H33F5N4 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | 2-amino-N'-methyl-N-[[2-(trifluoromethyl)phenyl]methyl]cycloheptene-1-carboximidamide;2,4-difluoro-6-propylaniline |
| SMILES | C/N=C(\NCc1ccccc1C(F)(F)F)C1=C(N)CCCCC1.CCCc1cc(F)cc(F)c1N |
| InChI | InChI=1S/C17H22F3N3.C9H11F2N/c1-22-16(13-8-3-2-4-10-15(13)21)23-11-12-7-5-6-9-14(12)17(18,19)20;1-2-3-6-4-7(10)5-8(11)9(6)12/h5-7,9H,2-4,8,10-11,21H2,1H3,(H,22,23);4-5H,2-3,12H2,1H3 |
| InChIKey | RYYTUFCPPQUMJN-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|