2-ethyl-1,2-oxazolidine-3,4-dicarboxylic acid

C7H11NO5 — CID 142128556

IUPAC2-ethyl-1,2-oxazolidine-3,4-dicarboxylic acid
SMILESCCN1OCC(C(=O)O)C1C(=O)O
InChIInChI=1S/C7H11NO5/c1-2-8-5(7(11)12)4(3-13-8)6(9)10/h4-5H,2-3H2,1H3,(H,9,10)(H,11,12)
InChIKeyVQIVUTPKUVQQJK-UHFFFAOYSA-N
MW189.17 g/mol
LogP-0.59
Rot. Bonds3

About 2-ethyl-1,2-oxazolidine-3,4-dicarboxylic acid

2-ethyl-1,2-oxazolidine-3,4-dicarboxylic acid (PubChem CID 142128556) has the molecular formula C7H11NO5 and a molecular weight of 189.17 g/mol. Its IUPAC name is 2-ethyl-1,2-oxazolidine-3,4-dicarboxylic acid.

Molecular Properties

Compound Name2-ethyl-1,2-oxazolidine-3,4-dicarboxylic acid
PubChem CID142128556
Molecular FormulaC7H11NO5
Molecular Weight189.17 g/mol
Exact Mass189.06
IUPAC Name2-ethyl-1,2-oxazolidine-3,4-dicarboxylic acid
SMILESCCN1OCC(C(=O)O)C1C(=O)O
InChIInChI=1S/C7H11NO5/c1-2-8-5(7(11)12)4(3-13-8)6(9)10/h4-5H,2-3H2,1H3,(H,9,10)(H,11,12)
InChIKeyVQIVUTPKUVQQJK-UHFFFAOYSA-N
XLogP-0.59
TPSA87.07 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500189.17
LogP ≤ 5-0.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-ethyl-1,2-oxazolidine-3,4-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethyl-1,2-oxazolidine-3,4-dicarboxylic acid?
The IUPAC name of 2-ethyl-1,2-oxazolidine-3,4-dicarboxylic acid (CID 142128556) is 2-ethyl-1,2-oxazolidine-3,4-dicarboxylic acid.
What is the SMILES notation for 2-ethyl-1,2-oxazolidine-3,4-dicarboxylic acid?
The canonical SMILES for 2-ethyl-1,2-oxazolidine-3,4-dicarboxylic acid is CCN1OCC(C(=O)O)C1C(=O)O.
What is the InChIKey of 2-ethyl-1,2-oxazolidine-3,4-dicarboxylic acid?
The InChIKey is VQIVUTPKUVQQJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO5/c1-2-8-5(7(11)12)4(3-13-8)6(9)10/h4-5H,2-3H2,1H3,(H,9,10)(H,11,12).
What are the key properties of 2-ethyl-1,2-oxazolidine-3,4-dicarboxylic acid?
2-ethyl-1,2-oxazolidine-3,4-dicarboxylic acid has a molecular weight of 189.17 g/mol, XLogP of -0.59, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1,2-oxazolidine-3,4-dicarboxylic acid is sourced from PubChem (CID 142128556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).