C7H11NO5 — CID 142128556
2-ethyl-1,2-oxazolidine-3,4-dicarboxylic acid (PubChem CID 142128556) has the molecular formula C7H11NO5 and a molecular weight of 189.17 g/mol. Its IUPAC name is 2-ethyl-1,2-oxazolidine-3,4-dicarboxylic acid.
| Compound Name | 2-ethyl-1,2-oxazolidine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 142128556 |
| Molecular Formula | C7H11NO5 |
| Molecular Weight | 189.17 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | 2-ethyl-1,2-oxazolidine-3,4-dicarboxylic acid |
| SMILES | CCN1OCC(C(=O)O)C1C(=O)O |
| InChI | InChI=1S/C7H11NO5/c1-2-8-5(7(11)12)4(3-13-8)6(9)10/h4-5H,2-3H2,1H3,(H,9,10)(H,11,12) |
| InChIKey | VQIVUTPKUVQQJK-UHFFFAOYSA-N |
| XLogP | -0.59 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.17 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |