C8H10N2O8 — CID 167313718
piperazine-1,2,3,4-tetracarboxylic acid (PubChem CID 167313718) has the molecular formula C8H10N2O8 and a molecular weight of 262.17 g/mol. Its IUPAC name is piperazine-1,2,3,4-tetracarboxylic acid.
| Compound Name | piperazine-1,2,3,4-tetracarboxylic acid |
|---|---|
| PubChem CID | 167313718 |
| Molecular Formula | C8H10N2O8 |
| Molecular Weight | 262.17 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | piperazine-1,2,3,4-tetracarboxylic acid |
| SMILES | O=C(O)C1C(C(=O)O)N(C(=O)O)CCN1C(=O)O |
| InChI | InChI=1S/C8H10N2O8/c11-5(12)3-4(6(13)14)10(8(17)18)2-1-9(3)7(15)16/h3-4H,1-2H2,(H,11,12)(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | VIYZDWMGBJMCBA-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 155.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.17 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |