piperazine-1,2,3,4-tetracarboxylic acid

C8H10N2O8 — CID 167313718

IUPACpiperazine-1,2,3,4-tetracarboxylic acid
SMILESO=C(O)C1C(C(=O)O)N(C(=O)O)CCN1C(=O)O
InChIInChI=1S/C8H10N2O8/c11-5(12)3-4(6(13)14)10(8(17)18)2-1-9(3)7(15)16/h3-4H,1-2H2,(H,11,12)(H,13,14)(H,15,16)(H,17,18)
InChIKeyVIYZDWMGBJMCBA-UHFFFAOYSA-N
MW262.17 g/mol
LogP-1.13
Rot. Bonds2

About piperazine-1,2,3,4-tetracarboxylic acid

piperazine-1,2,3,4-tetracarboxylic acid (PubChem CID 167313718) has the molecular formula C8H10N2O8 and a molecular weight of 262.17 g/mol. Its IUPAC name is piperazine-1,2,3,4-tetracarboxylic acid.

Molecular Properties

Compound Namepiperazine-1,2,3,4-tetracarboxylic acid
PubChem CID167313718
Molecular FormulaC8H10N2O8
Molecular Weight262.17 g/mol
Exact Mass262.04
IUPAC Namepiperazine-1,2,3,4-tetracarboxylic acid
SMILESO=C(O)C1C(C(=O)O)N(C(=O)O)CCN1C(=O)O
InChIInChI=1S/C8H10N2O8/c11-5(12)3-4(6(13)14)10(8(17)18)2-1-9(3)7(15)16/h3-4H,1-2H2,(H,11,12)(H,13,14)(H,15,16)(H,17,18)
InChIKeyVIYZDWMGBJMCBA-UHFFFAOYSA-N
XLogP-1.13
TPSA155.68 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.17
LogP ≤ 5-1.13
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze piperazine-1,2,3,4-tetracarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of piperazine-1,2,3,4-tetracarboxylic acid?
The IUPAC name of piperazine-1,2,3,4-tetracarboxylic acid (CID 167313718) is piperazine-1,2,3,4-tetracarboxylic acid.
What is the SMILES notation for piperazine-1,2,3,4-tetracarboxylic acid?
The canonical SMILES for piperazine-1,2,3,4-tetracarboxylic acid is O=C(O)C1C(C(=O)O)N(C(=O)O)CCN1C(=O)O.
What is the InChIKey of piperazine-1,2,3,4-tetracarboxylic acid?
The InChIKey is VIYZDWMGBJMCBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O8/c11-5(12)3-4(6(13)14)10(8(17)18)2-1-9(3)7(15)16/h3-4H,1-2H2,(H,11,12)(H,13,14)(H,15,16)(H,17,18).
What are the key properties of piperazine-1,2,3,4-tetracarboxylic acid?
piperazine-1,2,3,4-tetracarboxylic acid has a molecular weight of 262.17 g/mol, XLogP of -1.13, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine-1,2,3,4-tetracarboxylic acid is sourced from PubChem (CID 167313718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).