C7H15N3O2 — CID 70037623
2-(aminomethyl)-4-methylpiperazine-1-carboxylic acid (PubChem CID 70037623) has the molecular formula C7H15N3O2 and a molecular weight of 173.22 g/mol. Its IUPAC name is 2-(aminomethyl)-4-methylpiperazine-1-carboxylic acid.
| Compound Name | 2-(aminomethyl)-4-methylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 70037623 |
| Molecular Formula | C7H15N3O2 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2-(aminomethyl)-4-methylpiperazine-1-carboxylic acid |
| SMILES | CN1CCN(C(=O)O)C(CN)C1 |
| InChI | InChI=1S/C7H15N3O2/c1-9-2-3-10(7(11)12)6(4-8)5-9/h6H,2-5,8H2,1H3,(H,11,12) |
| InChIKey | PETVELKRGNATKW-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |