C9H17N3O — CID 80504839
1-[2-(aminomethyl)-4-methylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 80504839) has the molecular formula C9H17N3O and a molecular weight of 183.25 g/mol. Its IUPAC name is 1-[2-(aminomethyl)-4-methylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[2-(aminomethyl)-4-methylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 80504839 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 1-[2-(aminomethyl)-4-methylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCN(C)CC1CN |
| InChI | InChI=1S/C9H17N3O/c1-3-9(13)12-5-4-11(2)7-8(12)6-10/h3,8H,1,4-7,10H2,2H3 |
| InChIKey | LFPRWAMZBVANJU-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|