(2R,3S,4R)-4-amino-3-fluoropyrrolidine-1,2-dicarboxylic acid

C6H9FN2O4 — CID 123648982

IUPAC(2R,3S,4R)-4-amino-3-fluoropyrrolidine-1,2-dicarboxylic acid
SMILESN[C@@H]1CN(C(=O)O)[C@H](C(=O)O)[C@H]1F
InChIInChI=1S/C6H9FN2O4/c7-3-2(8)1-9(6(12)13)4(3)5(10)11/h2-4H,1,8H2,(H,10,11)(H,12,13)/t2-,3+,4+/m1/s1
InChIKeyIBDHBQSUQMLRCC-UZBSEBFBSA-N
MW192.15 g/mol
LogP-0.90
Rot. Bonds1

About (2R,3S,4R)-4-amino-3-fluoropyrrolidine-1,2-dicarboxylic acid

(2R,3S,4R)-4-amino-3-fluoropyrrolidine-1,2-dicarboxylic acid (PubChem CID 123648982) has the molecular formula C6H9FN2O4 and a molecular weight of 192.15 g/mol. Its IUPAC name is (2R,3S,4R)-4-amino-3-fluoropyrrolidine-1,2-dicarboxylic acid.

Molecular Properties

Compound Name(2R,3S,4R)-4-amino-3-fluoropyrrolidine-1,2-dicarboxylic acid
PubChem CID123648982
Molecular FormulaC6H9FN2O4
Molecular Weight192.15 g/mol
Exact Mass192.05
IUPAC Name(2R,3S,4R)-4-amino-3-fluoropyrrolidine-1,2-dicarboxylic acid
SMILESN[C@@H]1CN(C(=O)O)[C@H](C(=O)O)[C@H]1F
InChIInChI=1S/C6H9FN2O4/c7-3-2(8)1-9(6(12)13)4(3)5(10)11/h2-4H,1,8H2,(H,10,11)(H,12,13)/t2-,3+,4+/m1/s1
InChIKeyIBDHBQSUQMLRCC-UZBSEBFBSA-N
XLogP-0.90
TPSA103.86 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.15
LogP ≤ 5-0.90
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze (2R,3S,4R)-4-amino-3-fluoropyrrolidine-1,2-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R,3S,4R)-4-amino-3-fluoropyrrolidine-1,2-dicarboxylic acid?
The IUPAC name of (2R,3S,4R)-4-amino-3-fluoropyrrolidine-1,2-dicarboxylic acid (CID 123648982) is (2R,3S,4R)-4-amino-3-fluoropyrrolidine-1,2-dicarboxylic acid.
What is the SMILES notation for (2R,3S,4R)-4-amino-3-fluoropyrrolidine-1,2-dicarboxylic acid?
The canonical SMILES for (2R,3S,4R)-4-amino-3-fluoropyrrolidine-1,2-dicarboxylic acid is N[C@@H]1CN(C(=O)O)[C@H](C(=O)O)[C@H]1F.
What is the InChIKey of (2R,3S,4R)-4-amino-3-fluoropyrrolidine-1,2-dicarboxylic acid?
The InChIKey is IBDHBQSUQMLRCC-UZBSEBFBSA-N. The full InChI is InChI=1S/C6H9FN2O4/c7-3-2(8)1-9(6(12)13)4(3)5(10)11/h2-4H,1,8H2,(H,10,11)(H,12,13)/t2-,3+,4+/m1/s1.
What are the key properties of (2R,3S,4R)-4-amino-3-fluoropyrrolidine-1,2-dicarboxylic acid?
(2R,3S,4R)-4-amino-3-fluoropyrrolidine-1,2-dicarboxylic acid has a molecular weight of 192.15 g/mol, XLogP of -0.90, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S,4R)-4-amino-3-fluoropyrrolidine-1,2-dicarboxylic acid is sourced from PubChem (CID 123648982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).