(2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylic acid

C7H10FNO4 — CID 122439706

IUPAC(2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylic acid
SMILESCC1C(F)CN(C(=O)O)[C@@H]1C(=O)O
InChIInChI=1S/C7H10FNO4/c1-3-4(8)2-9(7(12)13)5(3)6(10)11/h3-5H,2H2,1H3,(H,10,11)(H,12,13)/t3?,4?,5-/m0/s1
InChIKeyFRHMHKZWDGMVFR-YCXLAJEKSA-N
MW191.16 g/mol
LogP0.41
Rot. Bonds1

About (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylic acid

(2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylic acid (PubChem CID 122439706) has the molecular formula C7H10FNO4 and a molecular weight of 191.16 g/mol. Its IUPAC name is (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylic acid.

Molecular Properties

Compound Name(2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylic acid
PubChem CID122439706
Molecular FormulaC7H10FNO4
Molecular Weight191.16 g/mol
Exact Mass191.06
IUPAC Name(2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylic acid
SMILESCC1C(F)CN(C(=O)O)[C@@H]1C(=O)O
InChIInChI=1S/C7H10FNO4/c1-3-4(8)2-9(7(12)13)5(3)6(10)11/h3-5H,2H2,1H3,(H,10,11)(H,12,13)/t3?,4?,5-/m0/s1
InChIKeyFRHMHKZWDGMVFR-YCXLAJEKSA-N
XLogP0.41
TPSA77.84 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.16
LogP ≤ 50.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylic acid?
The IUPAC name of (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylic acid (CID 122439706) is (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylic acid.
What is the SMILES notation for (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylic acid?
The canonical SMILES for (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylic acid is CC1C(F)CN(C(=O)O)[C@@H]1C(=O)O.
What is the InChIKey of (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylic acid?
The InChIKey is FRHMHKZWDGMVFR-YCXLAJEKSA-N. The full InChI is InChI=1S/C7H10FNO4/c1-3-4(8)2-9(7(12)13)5(3)6(10)11/h3-5H,2H2,1H3,(H,10,11)(H,12,13)/t3?,4?,5-/m0/s1.
What are the key properties of (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylic acid?
(2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylic acid has a molecular weight of 191.16 g/mol, XLogP of 0.41, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylic acid is sourced from PubChem (CID 122439706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).