C7H10FNO4 — CID 122439706
(2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylic acid (PubChem CID 122439706) has the molecular formula C7H10FNO4 and a molecular weight of 191.16 g/mol. Its IUPAC name is (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 122439706 |
| Molecular Formula | C7H10FNO4 |
| Molecular Weight | 191.16 g/mol |
| Exact Mass | 191.06 |
| IUPAC Name | (2S)-4-fluoro-3-methylpyrrolidine-1,2-dicarboxylic acid |
| SMILES | CC1C(F)CN(C(=O)O)[C@@H]1C(=O)O |
| InChI | InChI=1S/C7H10FNO4/c1-3-4(8)2-9(7(12)13)5(3)6(10)11/h3-5H,2H2,1H3,(H,10,11)(H,12,13)/t3?,4?,5-/m0/s1 |
| InChIKey | FRHMHKZWDGMVFR-YCXLAJEKSA-N |
| XLogP | 0.41 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.16 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |