C6H7FN4O4 — CID 123726334
(2R,3R,4R)-4-azido-3-fluoropyrrolidine-1,2-dicarboxylic acid (PubChem CID 123726334) has the molecular formula C6H7FN4O4 and a molecular weight of 218.14 g/mol. Its IUPAC name is (2R,3R,4R)-4-azido-3-fluoropyrrolidine-1,2-dicarboxylic acid.
| Compound Name | (2R,3R,4R)-4-azido-3-fluoropyrrolidine-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 123726334 |
| Molecular Formula | C6H7FN4O4 |
| Molecular Weight | 218.14 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | (2R,3R,4R)-4-azido-3-fluoropyrrolidine-1,2-dicarboxylic acid |
| SMILES | [N-]=[N+]=N[C@@H]1CN(C(=O)O)[C@H](C(=O)O)[C@H]1F |
| InChI | InChI=1S/C6H7FN4O4/c7-3-2(9-10-8)1-11(6(14)15)4(3)5(12)13/h2-4H,1H2,(H,12,13)(H,14,15)/t2-,3+,4+/m1/s1 |
| InChIKey | YUWWWYFWJIADDV-UZBSEBFBSA-N |
| XLogP | 0.45 |
| TPSA | 126.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.14 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|