C5H8N4O2 — CID 86638431
(2S,3S)-3-azidopyrrolidine-2-carboxylic acid (PubChem CID 86638431) has the molecular formula C5H8N4O2 and a molecular weight of 156.14 g/mol. Its IUPAC name is (2S,3S)-3-azidopyrrolidine-2-carboxylic acid.
| Compound Name | (2S,3S)-3-azidopyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 86638431 |
| Molecular Formula | C5H8N4O2 |
| Molecular Weight | 156.14 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | (2S,3S)-3-azidopyrrolidine-2-carboxylic acid |
| SMILES | [N-]=[N+]=N[C@H]1CCN[C@@H]1C(=O)O |
| InChI | InChI=1S/C5H8N4O2/c6-9-8-3-1-2-7-4(3)5(10)11/h3-4,7H,1-2H2,(H,10,11)/t3-,4-/m0/s1 |
| InChIKey | HCNJYUKJYQMDQL-IMJSIDKUSA-N |
| XLogP | 0.11 |
| TPSA | 98.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.14 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|