C6H7F2NO4 — CID 22181540
4,5-difluoropyrrolidine-1,3-dicarboxylic acid (PubChem CID 22181540) has the molecular formula C6H7F2NO4 and a molecular weight of 195.12 g/mol. Its IUPAC name is 4,5-difluoropyrrolidine-1,3-dicarboxylic acid.
| Compound Name | 4,5-difluoropyrrolidine-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 22181540 |
| Molecular Formula | C6H7F2NO4 |
| Molecular Weight | 195.12 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | 4,5-difluoropyrrolidine-1,3-dicarboxylic acid |
| SMILES | O=C(O)C1CN(C(=O)O)C(F)C1F |
| InChI | InChI=1S/C6H7F2NO4/c7-3-2(5(10)11)1-9(4(3)8)6(12)13/h2-4H,1H2,(H,10,11)(H,12,13) |
| InChIKey | BDSJTHMNEMSYLU-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.12 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|