(1R)-2-fluorocyclopropane-1-carboxylic acid

C4H5FO2 — CID 126485045

IUPAC(1R)-2-fluorocyclopropane-1-carboxylic acid
SMILESO=C(O)[C@H]1CC1F
InChIInChI=1S/C4H5FO2/c5-3-1-2(3)4(6)7/h2-3H,1H2,(H,6,7)/t2-,3?/m0/s1
InChIKeyHZQKMZGKYVDMCT-SCQFTWEKSA-N
MW104.08 g/mol
LogP0.43
Rot. Bonds1

About (1R)-2-fluorocyclopropane-1-carboxylic acid

(1R)-2-fluorocyclopropane-1-carboxylic acid (PubChem CID 126485045) has the molecular formula C4H5FO2 and a molecular weight of 104.08 g/mol. Its IUPAC name is (1R)-2-fluorocyclopropane-1-carboxylic acid.

Molecular Properties

Compound Name(1R)-2-fluorocyclopropane-1-carboxylic acid
PubChem CID126485045
Molecular FormulaC4H5FO2
Molecular Weight104.08 g/mol
Exact Mass104.03
IUPAC Name(1R)-2-fluorocyclopropane-1-carboxylic acid
SMILESO=C(O)[C@H]1CC1F
InChIInChI=1S/C4H5FO2/c5-3-1-2(3)4(6)7/h2-3H,1H2,(H,6,7)/t2-,3?/m0/s1
InChIKeyHZQKMZGKYVDMCT-SCQFTWEKSA-N
XLogP0.43
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500104.08
LogP ≤ 50.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze (1R)-2-fluorocyclopropane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2R)-cyclobutane-1,2-dicarboxylic acid
CID 135193426
cis-(1R,2S)-cyclopropane-1,2-dicarboxylic acid
CID 726455
2-fluorocyclopropane-1-carbonyl iodide
CID 118532290
sodium cis-(1S,2S)-2-fluorocyclopropane-1-carboxylate
CID 67083304
cis-(1R,2R)-2-fluorocyclopropane-1-carboxamide
CID 119095885
(2S)-2-methylcyclopropane-1-carboxylic acid
CID 70278837
trans-(1R,2R)-2-methylcyclopropane-1-carboxylic acid
CID 6995705
1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-2,3,6,7-tetracarboxylic acid
CID 67173351
4-fluoro-1,1-dioxothiolane-3-carboxylic acid
CID 83854510
2,3-difluoro-4-hydroxycyclohexane-1-carboxylic acid
CID 174740400
cis-(1R,4S)-2,5-dimethylcyclohexane-1,4-dicarboxylic acid
CID 22841267
(1R,2S,4R,5S)-4,5-dihydroxycyclohexane-1,2-dicarboxylic acid
CID 68905410

Frequently Asked Questions

What is the IUPAC name of (1R)-2-fluorocyclopropane-1-carboxylic acid?
The IUPAC name of (1R)-2-fluorocyclopropane-1-carboxylic acid (CID 126485045) is (1R)-2-fluorocyclopropane-1-carboxylic acid.
What is the SMILES notation for (1R)-2-fluorocyclopropane-1-carboxylic acid?
The canonical SMILES for (1R)-2-fluorocyclopropane-1-carboxylic acid is O=C(O)[C@H]1CC1F.
What is the InChIKey of (1R)-2-fluorocyclopropane-1-carboxylic acid?
The InChIKey is HZQKMZGKYVDMCT-SCQFTWEKSA-N. The full InChI is InChI=1S/C4H5FO2/c5-3-1-2(3)4(6)7/h2-3H,1H2,(H,6,7)/t2-,3?/m0/s1.
What are the key properties of (1R)-2-fluorocyclopropane-1-carboxylic acid?
(1R)-2-fluorocyclopropane-1-carboxylic acid has a molecular weight of 104.08 g/mol, XLogP of 0.43, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2-fluorocyclopropane-1-carboxylic acid is sourced from PubChem (CID 126485045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).