C17H15FN2O4S — CID 142129766
N'-(4-fluorophenyl)sulfanyl-3,7-dimethoxy-1-benzofuran-2-carbohydrazide (PubChem CID 142129766) has the molecular formula C17H15FN2O4S and a molecular weight of 362.38 g/mol. Its IUPAC name is N'-(4-fluorophenyl)sulfanyl-3,7-dimethoxy-1-benzofuran-2-carbohydrazide.
| Compound Name | N'-(4-fluorophenyl)sulfanyl-3,7-dimethoxy-1-benzofuran-2-carbohydrazide |
|---|---|
| PubChem CID | 142129766 |
| Molecular Formula | C17H15FN2O4S |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | N'-(4-fluorophenyl)sulfanyl-3,7-dimethoxy-1-benzofuran-2-carbohydrazide |
| SMILES | COc1c(C(=O)NNSc2ccc(F)cc2)oc2c(OC)cccc12 |
| InChI | InChI=1S/C17H15FN2O4S/c1-22-13-5-3-4-12-14(13)24-16(15(12)23-2)17(21)19-20-25-11-8-6-10(18)7-9-11/h3-9,20H,1-2H3,(H,19,21) |
| InChIKey | PSHGDRQPSKHYLK-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|