C18H33NO2 — CID 14212989
tert-butyl N-[(E)-1-cyclohexyl-5-methylhex-3-en-2-yl]carbamate (PubChem CID 14212989) has the molecular formula C18H33NO2 and a molecular weight of 295.47 g/mol. Its IUPAC name is tert-butyl N-[(E)-1-cyclohexyl-5-methylhex-3-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(E)-1-cyclohexyl-5-methylhex-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 14212989 |
| Molecular Formula | C18H33NO2 |
| Molecular Weight | 295.47 g/mol |
| Exact Mass | 295.25 |
| IUPAC Name | tert-butyl N-[(E)-1-cyclohexyl-5-methylhex-3-en-2-yl]carbamate |
| SMILES | CC(C)/C=C/C(CC1CCCCC1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H33NO2/c1-14(2)11-12-16(13-15-9-7-6-8-10-15)19-17(20)21-18(3,4)5/h11-12,14-16H,6-10,13H2,1-5H3,(H,19,20)/b12-11+ |
| InChIKey | IQDALHRZLRZXRM-VAWYXSNFSA-N |
| XLogP | 5.06 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.47 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|