C39H48N4O5 — CID 142131267
N-ethyl-N'-(4-phenylphenyl)octanediamide;N'-hydroxy-N-naphthalen-2-ylheptanediamide (PubChem CID 142131267) has the molecular formula C39H48N4O5 and a molecular weight of 652.84 g/mol. Its IUPAC name is N-ethyl-N'-(4-phenylphenyl)octanediamide;N'-hydroxy-N-naphthalen-2-ylheptanediamide.
| Compound Name | N-ethyl-N'-(4-phenylphenyl)octanediamide;N'-hydroxy-N-naphthalen-2-ylheptanediamide |
|---|---|
| PubChem CID | 142131267 |
| Molecular Formula | C39H48N4O5 |
| Molecular Weight | 652.84 g/mol |
| Exact Mass | 652.36 |
| IUPAC Name | N-ethyl-N'-(4-phenylphenyl)octanediamide;N'-hydroxy-N-naphthalen-2-ylheptanediamide |
| SMILES | CCNC(=O)CCCCCCC(=O)Nc1ccc(-c2ccccc2)cc1.O=C(CCCCCC(=O)Nc1ccc2ccccc2c1)NO |
| InChI | InChI=1S/C22H28N2O2.C17H20N2O3/c1-2-23-21(25)12-8-3-4-9-13-22(26)24-20-16-14-19(15-17-20)18-10-6-5-7-11-18;20-16(8-2-1-3-9-17(21)19-22)18-15-11-10-13-6-4-5-7-14(13)12-15/h5-7,10-11,14-17H,2-4,8-9,12-13H2,1H3,(H,23,25)(H,24,26);4-7,10-12,22H,1-3,8-9H2,(H,18,20)(H,19,21) |
| InChIKey | MJYQETWJTDJTHS-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 136.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.84 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|