C7H13NS — CID 142131403
4,5-dimethyl-1-sulfanyl-3,6-dihydro-2H-pyridine (PubChem CID 142131403) has the molecular formula C7H13NS and a molecular weight of 143.25 g/mol. Its IUPAC name is 4,5-dimethyl-1-sulfanyl-3,6-dihydro-2H-pyridine.
| Compound Name | 4,5-dimethyl-1-sulfanyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 142131403 |
| Molecular Formula | C7H13NS |
| Molecular Weight | 143.25 g/mol |
| Exact Mass | 143.08 |
| IUPAC Name | 4,5-dimethyl-1-sulfanyl-3,6-dihydro-2H-pyridine |
| SMILES | CC1=C(C)CN(S)CC1 |
| InChI | InChI=1S/C7H13NS/c1-6-3-4-8(9)5-7(6)2/h9H,3-5H2,1-2H3 |
| InChIKey | FEAPBQFPTIZFPR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|