About 4,5-dimethyl-1-sulfanyl-3,6-dihydro-2H-pyridine
4,5-dimethyl-1-sulfanyl-3,6-dihydro-2H-pyridine (PubChem CID 142131403) has the molecular formula C7H13NS
and a molecular weight of 143.25 g/mol. Its IUPAC name is 4,5-dimethyl-1-sulfanyl-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 4,5-dimethyl-1-sulfanyl-3,6-dihydro-2H-pyridine |
| PubChem CID | 142131403 |
| Molecular Formula | C7H13NS |
| Molecular Weight | 143.25 g/mol |
| Exact Mass | 143.08 |
| IUPAC Name | 4,5-dimethyl-1-sulfanyl-3,6-dihydro-2H-pyridine |
| SMILES | CC1=C(C)CN(S)CC1 |
| InChI | InChI=1S/C7H13NS/c1-6-3-4-8(9)5-7(6)2/h9H,3-5H2,1-2H3 |
| InChIKey | FEAPBQFPTIZFPR-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dimethyl-1-sulfanyl-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dimethyl-1-sulfanyl-3,6-dihydro-2H-pyridine?
The IUPAC name of 4,5-dimethyl-1-sulfanyl-3,6-dihydro-2H-pyridine (CID 142131403) is 4,5-dimethyl-1-sulfanyl-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 4,5-dimethyl-1-sulfanyl-3,6-dihydro-2H-pyridine?
The canonical SMILES for 4,5-dimethyl-1-sulfanyl-3,6-dihydro-2H-pyridine is CC1=C(C)CN(S)CC1.
What is the InChIKey of 4,5-dimethyl-1-sulfanyl-3,6-dihydro-2H-pyridine?
The InChIKey is FEAPBQFPTIZFPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NS/c1-6-3-4-8(9)5-7(6)2/h9H,3-5H2,1-2H3.
What are the key properties of 4,5-dimethyl-1-sulfanyl-3,6-dihydro-2H-pyridine?
4,5-dimethyl-1-sulfanyl-3,6-dihydro-2H-pyridine has a molecular weight of 143.25 g/mol, XLogP of 1.87, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dimethyl-1-sulfanyl-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 142131403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).