C18H30N4 — CID 142133968
7,8-dihydrobenzo[g]quinoxaline-2,3-diamine;ethane (PubChem CID 142133968) has the molecular formula C18H30N4 and a molecular weight of 302.47 g/mol. Its IUPAC name is 7,8-dihydrobenzo[g]quinoxaline-2,3-diamine;ethane.
| Compound Name | 7,8-dihydrobenzo[g]quinoxaline-2,3-diamine;ethane |
|---|---|
| PubChem CID | 142133968 |
| Molecular Formula | C18H30N4 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | 7,8-dihydrobenzo[g]quinoxaline-2,3-diamine;ethane |
| SMILES | CC.CC.CC.Nc1nc2cc3c(cc2nc1N)=CCCC=3 |
| InChI | InChI=1S/C12H12N4.3C2H6/c13-11-12(14)16-10-6-8-4-2-1-3-7(8)5-9(10)15-11;3*1-2/h3-6H,1-2H2,(H2,13,15)(H2,14,16);3*1-2H3 |
| InChIKey | MSQRZFPNCOYTAQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |