About 1-[(Z,2E)-2-ethylidenepent-3-enyl]-3-(2-oxo-1H-pyrimidin-6-yl)urea
1-[(Z,2E)-2-ethylidenepent-3-enyl]-3-(2-oxo-1H-pyrimidin-6-yl)urea (PubChem CID 142134205) has the molecular formula C12H16N4O2
and a molecular weight of 248.29 g/mol. Its IUPAC name is 1-[(Z,2E)-2-ethylidenepent-3-enyl]-3-(2-oxo-1H-pyrimidin-6-yl)urea.
Molecular Properties
| Compound Name | 1-[(Z,2E)-2-ethylidenepent-3-enyl]-3-(2-oxo-1H-pyrimidin-6-yl)urea |
| PubChem CID | 142134205 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1-[(Z,2E)-2-ethylidenepent-3-enyl]-3-(2-oxo-1H-pyrimidin-6-yl)urea |
| SMILES | C/C=C\C(=C/C)CNC(=O)Nc1ccnc(=O)[nH]1 |
| InChI | InChI=1S/C12H16N4O2/c1-3-5-9(4-2)8-14-12(18)16-10-6-7-13-11(17)15-10/h3-7H,8H2,1-2H3,(H3,13,14,15,16,17,18)/b5-3-,9-4+ |
| InChIKey | BFRFGVJUNYXSLB-LWUTYWFWSA-N |
| XLogP | 1.41 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(Z,2E)-2-ethylidenepent-3-enyl]-3-(2-oxo-1H-pyrimidin-6-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z,2E)-2-ethylidenepent-3-enyl]-3-(2-oxo-1H-pyrimidin-6-yl)urea?
The IUPAC name of 1-[(Z,2E)-2-ethylidenepent-3-enyl]-3-(2-oxo-1H-pyrimidin-6-yl)urea (CID 142134205) is 1-[(Z,2E)-2-ethylidenepent-3-enyl]-3-(2-oxo-1H-pyrimidin-6-yl)urea.
What is the SMILES notation for 1-[(Z,2E)-2-ethylidenepent-3-enyl]-3-(2-oxo-1H-pyrimidin-6-yl)urea?
The canonical SMILES for 1-[(Z,2E)-2-ethylidenepent-3-enyl]-3-(2-oxo-1H-pyrimidin-6-yl)urea is C/C=C\C(=C/C)CNC(=O)Nc1ccnc(=O)[nH]1.
What is the InChIKey of 1-[(Z,2E)-2-ethylidenepent-3-enyl]-3-(2-oxo-1H-pyrimidin-6-yl)urea?
The InChIKey is BFRFGVJUNYXSLB-LWUTYWFWSA-N. The full InChI is InChI=1S/C12H16N4O2/c1-3-5-9(4-2)8-14-12(18)16-10-6-7-13-11(17)15-10/h3-7H,8H2,1-2H3,(H3,13,14,15,16,17,18)/b5-3-,9-4+.
What are the key properties of 1-[(Z,2E)-2-ethylidenepent-3-enyl]-3-(2-oxo-1H-pyrimidin-6-yl)urea?
1-[(Z,2E)-2-ethylidenepent-3-enyl]-3-(2-oxo-1H-pyrimidin-6-yl)urea has a molecular weight of 248.29 g/mol, XLogP of 1.41, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z,2E)-2-ethylidenepent-3-enyl]-3-(2-oxo-1H-pyrimidin-6-yl)urea is sourced from PubChem (CID 142134205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).