C12H16N4O2 — CID 142134205
1-[(Z,2E)-2-ethylidenepent-3-enyl]-3-(2-oxo-1H-pyrimidin-6-yl)urea (PubChem CID 142134205) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 1-[(Z,2E)-2-ethylidenepent-3-enyl]-3-(2-oxo-1H-pyrimidin-6-yl)urea.
| Compound Name | 1-[(Z,2E)-2-ethylidenepent-3-enyl]-3-(2-oxo-1H-pyrimidin-6-yl)urea |
|---|---|
| PubChem CID | 142134205 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1-[(Z,2E)-2-ethylidenepent-3-enyl]-3-(2-oxo-1H-pyrimidin-6-yl)urea |
| SMILES | C/C=C\C(=C/C)CNC(=O)Nc1ccnc(=O)[nH]1 |
| InChI | InChI=1S/C12H16N4O2/c1-3-5-9(4-2)8-14-12(18)16-10-6-7-13-11(17)15-10/h3-7H,8H2,1-2H3,(H3,13,14,15,16,17,18)/b5-3-,9-4+ |
| InChIKey | BFRFGVJUNYXSLB-LWUTYWFWSA-N |
| XLogP | 1.41 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|