C7H7N3O2 — CID 151290170
N-(2-oxo-1H-pyrimidin-6-yl)prop-2-enamide (PubChem CID 151290170) has the molecular formula C7H7N3O2 and a molecular weight of 165.15 g/mol. Its IUPAC name is N-(2-oxo-1H-pyrimidin-6-yl)prop-2-enamide.
| Compound Name | N-(2-oxo-1H-pyrimidin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 151290170 |
| Molecular Formula | C7H7N3O2 |
| Molecular Weight | 165.15 g/mol |
| Exact Mass | 165.05 |
| IUPAC Name | N-(2-oxo-1H-pyrimidin-6-yl)prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccnc(=O)[nH]1 |
| InChI | InChI=1S/C7H7N3O2/c1-2-6(11)9-5-3-4-8-7(12)10-5/h2-4H,1H2,(H2,8,9,10,11,12) |
| InChIKey | OAGMYUHJCYVCBW-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.15 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|