C14H19Cl2N3 — CID 142134307
1-[(3E,5E,7E)-6,8-dichloro-2,3-diethylocta-3,5,7-trienyl]-1,2,4-triazole (PubChem CID 142134307) has the molecular formula C14H19Cl2N3 and a molecular weight of 300.23 g/mol. Its IUPAC name is 1-[(3E,5E,7E)-6,8-dichloro-2,3-diethylocta-3,5,7-trienyl]-1,2,4-triazole.
| Compound Name | 1-[(3E,5E,7E)-6,8-dichloro-2,3-diethylocta-3,5,7-trienyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 142134307 |
| Molecular Formula | C14H19Cl2N3 |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1-[(3E,5E,7E)-6,8-dichloro-2,3-diethylocta-3,5,7-trienyl]-1,2,4-triazole |
| SMILES | CC/C(=C\C=C(Cl)/C=C/Cl)C(CC)Cn1cncn1 |
| InChI | InChI=1S/C14H19Cl2N3/c1-3-12(5-6-14(16)7-8-15)13(4-2)9-19-11-17-10-18-19/h5-8,10-11,13H,3-4,9H2,1-2H3/b8-7+,12-5+,14-6+ |
| InChIKey | PZHVJXCROXNNJK-ALVTWZEFSA-N |
| XLogP | 4.52 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|