C11H16FN3 — CID 144936995
1-[(3E)-2-ethyl-5-fluoro-3-methylhexa-3,5-dienyl]-1,2,4-triazole (PubChem CID 144936995) has the molecular formula C11H16FN3 and a molecular weight of 209.27 g/mol. Its IUPAC name is 1-[(3E)-2-ethyl-5-fluoro-3-methylhexa-3,5-dienyl]-1,2,4-triazole.
| Compound Name | 1-[(3E)-2-ethyl-5-fluoro-3-methylhexa-3,5-dienyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 144936995 |
| Molecular Formula | C11H16FN3 |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 1-[(3E)-2-ethyl-5-fluoro-3-methylhexa-3,5-dienyl]-1,2,4-triazole |
| SMILES | C=C(F)/C=C(\C)C(CC)Cn1cncn1 |
| InChI | InChI=1S/C11H16FN3/c1-4-11(9(2)5-10(3)12)6-15-8-13-7-14-15/h5,7-8,11H,3-4,6H2,1-2H3/b9-5+ |
| InChIKey | WKVJBBOPUQWCRN-WEVVVXLNSA-N |
| XLogP | 2.73 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|