C8H11NS3 — CID 142135656
(9E)-2,3,3a,5,6,8-hexahydrothieno[3,2-e][1,3]thiazocine-4-thione (PubChem CID 142135656) has the molecular formula C8H11NS3 and a molecular weight of 217.38 g/mol. Its IUPAC name is (9E)-2,3,3a,5,6,8-hexahydrothieno[3,2-e][1,3]thiazocine-4-thione.
| Compound Name | (9E)-2,3,3a,5,6,8-hexahydrothieno[3,2-e][1,3]thiazocine-4-thione |
|---|---|
| PubChem CID | 142135656 |
| Molecular Formula | C8H11NS3 |
| Molecular Weight | 217.38 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | (9E)-2,3,3a,5,6,8-hexahydrothieno[3,2-e][1,3]thiazocine-4-thione |
| SMILES | S=C1NCSC/C=C2/SCCC12 |
| InChI | InChI=1S/C8H11NS3/c10-8-6-1-4-12-7(6)2-3-11-5-9-8/h2,6H,1,3-5H2,(H,9,10)/b7-2+ |
| InChIKey | ACBKGIJLAMJJMB-FARCUNLSSA-N |
| XLogP | 2.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|