C26H32O5 — CID 142135793
[4-[(E)-2-(3,3-dimethyl-4-oxo-4-phenylbutoxy)ethenoxy]-2-methylbutan-2-yl] benzoate (PubChem CID 142135793) has the molecular formula C26H32O5 and a molecular weight of 424.54 g/mol. Its IUPAC name is [4-[(E)-2-(3,3-dimethyl-4-oxo-4-phenylbutoxy)ethenoxy]-2-methylbutan-2-yl] benzoate.
| Compound Name | [4-[(E)-2-(3,3-dimethyl-4-oxo-4-phenylbutoxy)ethenoxy]-2-methylbutan-2-yl] benzoate |
|---|---|
| PubChem CID | 142135793 |
| Molecular Formula | C26H32O5 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | [4-[(E)-2-(3,3-dimethyl-4-oxo-4-phenylbutoxy)ethenoxy]-2-methylbutan-2-yl] benzoate |
| SMILES | CC(C)(CCO/C=C/OCCC(C)(C)C(=O)c1ccccc1)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H32O5/c1-25(2,23(27)21-11-7-5-8-12-21)15-17-29-19-20-30-18-16-26(3,4)31-24(28)22-13-9-6-10-14-22/h5-14,19-20H,15-18H2,1-4H3/b20-19+ |
| InChIKey | JIZJPJCVOHPOPS-FMQUCBEESA-N |
| XLogP | 5.82 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|